Cbz-1-piperidine-3-acetic acid

Cbz-1-piperidine-3-acetic acid - Names and Identifiers

Name	N-Cbz-3-piperidineacetic acid
Synonyms	N-Cbz-3-piperidineacetic acid N-CBZ-3-PIPERIDINEACETIC ACID 1-Cbz-3-Piperidineacetic Acid Cbz-1-piperidine-3-acetic acid 1-Cbz-piperidine-3-acetic acid 1-N-CBZ-3-PIPERIDINEACETIC ACID {1-[(Benzyloxy)carbonyl]piperidin-3-yl}acetic acid 2-{1-[(benzyloxy)carbonyl]piperidin-3-yl}acetic acid 3-Piperidineacetic acid, 1-[(phenylmethoxy)carbonyl]- 3-Carboxymethyl-piperidine-1-carboxylic acid benzyl ester
CAS	86827-10-3
EINECS	1308068-626-2
InChI	InChI=1/C15H19NO4/c17-14(18)9-13-7-4-8-16(10-13)15(19)20-11-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,17,18)

Cbz-1-piperidine-3-acetic acid - Physico-chemical Properties

Molecular Formula	C15H19NO4
Molar Mass	277.32
Density	1.216g/cm³
Boling Point	460.1°C at 760 mmHg
Flash Point	232°C
Vapor Presure	2.93E-09mmHg at 25°C
Storage Condition	Sealed in dry,Room Temperature
Refractive Index	1.552

Cbz-1-piperidine-3-acetic acid - Risk and Safety

UN IDs

UN2811

Cbz-1-piperidine-3-acetic acid - Introduction

N-Cbz-3-piperidineacetic acid(N-Cbz-3-piperidineacetic acid) is an organic compound that has the following properties and uses:

Nature:
1. appearance: N-Cbz-3-piperidineacetic acid is a white or white crystalline powder.
2. Solubility: It is soluble in many organic solvents such as ethanol and dimethylformamide, insoluble in water.
3. melting point: the melting point of N-Cbz-3-piperidineacetic acid is about 70-75 c.

Use:
N-Cbz-3-piperidineacetic acid is commonly used in protecting groups (protecting group) and media in organic synthesis reactions. It has some of the following common uses:
1. protecting group: N-Cbz-3-piperidineacetic acid can be used as a protecting group for protecting amino (amino), which plays a protective role in the synthesis of certain organic compounds to prevent non-specific reactions.
2. Intermediate: It can also be used as an intermediate for a variety of synthetic reactions, such as synthetic drugs or organic compounds.

Preparation Method:
The preparation method of N-Cbz-3-piperidineacetic acid is as follows:
1. First, 3-piperidine acetic acid is reacted with dimethylformamide to generate 3-piperidine acetic anhydride.
2. Then, 3-piperidine acetic anhydride is reacted with benzyl chloroformate to generate N-Cbz-3-piperidineacetic acid.
3. Finally, purified by crystallization to obtain the desired product.

Safety Information:
N-Cbz-3-piperidineacetic acid is relatively safe under normal operating conditions, the following matters still need to be noted:
1. This is a chemical, please keep away from children and pets.
2. Avoid inhaling dust or contact with skin and eyes during use.
3. if accidentally inhaled or contact, should immediately wash with water, if there is difficulty breathing or irritation continues, please seek medical help.
4. During storage and handling, comply with chemical safety procedures and maintain a well-ventilated working environment.
5. Detailed safety information is available from chemical suppliers.

Last Update：2024-04-09 21:01:54